| Read Date | 2007-07-27 12:18:00 |
|---|---|
| Read Number | X0000090861533200707271218 |
| Week | 1 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | precip_skin |
| Cocktail | 7_C0576 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium acetate trihydrate | 5.0 | 0.1 M | [Na+].[O-]C(=O)C.O.O.O |
| Manganese chloride tetrahydrate | 5.0 | 0.1 M | [Mn+2].[Cl-].[Cl-].O.O.O.… |
| PEG 4000 | 5.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | ZR227 |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 140 aa |
| Mass | 15.45 kD |
| ext | 2980 |
| pI | 4.81 |
| Name | Hypothetical protein MW0656 |
| Database References | NCBI UniProt |
| PFAM | PF03479 |
| PDB Structures | 3HTN (Best Match) |
| Gene | |
|---|---|
| Organism | Staphylococcus aureus |
| Genus | Staphylococcus |
| Species | aureus |
| Strain | |
| Sequence | MKLQKSNHTILLVLEKGEDIVECITTFADDQDLTFTSVSGIGACDDVVLKFFNLTTKQYEEKHITEPLELTSLLGNISRLDNGHFAHLHATFGTQSYETFSGHLAKAIVSATAEIILTVTDLDIQRSFKDAVGLNLLDPQ |