| Read Date | 2007-07-27 10:08:00 |
|---|---|
| Read Number | X0000090881340200707271008 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | phase |
| Cocktail | 7_C1523 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| di-Ammonium Tartrate | 7.0 | 1.3 M | O=C([O-])C(O)C(O)C([O-])=… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | PsR211 |
|---|---|
| Spine Status | NMR structure |
| Length | 137 aa |
| Mass | 15.21 kD |
| ext | 2980 |
| pI | 10.61 |
| Name | Peptidyl-tRNA hydrolase domain protein |
| Database References | UniProt |
| PFAM | PF00472 |
| PDB Structures | 2JVA (NMR) |
| Gene | |
|---|---|
| Organism | Pseudomonas syringae |
| Genus | Pseudomonas |
| Species | syringae |
| Strain | |
| Sequence | MLVISNNVHLPDAEIELTAIRAQGAGGQNVNKVSSAMHLRFDINASSLPPFYKERLLALNDSRITSDGVIVLKAQQYRTQEQNRADALLRLSELIVNAAKVEKKRRPTRPTLGSKTRRLESKSKRGSIKAGRGKVDF |