| Read Date | 2007-08-06 10:19:00 |
|---|---|
| Read Number | X0000091100947200708061019 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 7_C0729 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| CAPS | 10.0 | 0.1 M | O=S(=O)(O)CCCNC1CCCCC1 |
| Potassium nitrate | 10.0 | 0.1 M | [K+].[O-][N+]([O-])=O |
| PEG 1000 | 10.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | TR24 |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 198 aa |
| Mass | 21.22 kD |
| ext | 2980 |
| pI | 8.70 |
| Name | Methyl-coenzyme M reductase I operon protein C |
| Database References | NCBI UniProt |
| PFAM | PF04609 |
| PDB Structures | 4RJZ (Best Match) |
| Gene | |
|---|---|
| Organism | Methanobacterium thermoautotrophicum |
| Genus | Methanothermobacter |
| Species | thermautotrophicus |
| Strain | |
| Sequence | MIGKCTHVVDCRETMGMGEGGGIAQRGTFAQCGSEVLAVAMSPGRRHITKPVCEITFALREANIMTSTIVLNAGAGVPQDAPSAGAGSLFGLTPAEVEQMKRHKLLVVHLGGVKNHITYKARLILRNVDRPCIIICEYPVDFEDFAKIGVRTRAVMPDEPKTKGTIVDIVSGVIRGETCPQEKLDEIIRKVKLALGGA |