 
    | Read Date | 2007-08-06 10:20:00 | 
|---|---|
| Read Number | X0000091100875200708061020 | 
| Week | 0 | 
| Verified Crystal | |
| 3-Way Classifier | other | 
| 10-Way Classifier | precip | 
| Cocktail | 7_C0339 | 
| Screen | HWI Generation 7 | 
| Name | pH | Concentration | SMILES | 
|---|---|---|---|
| CAPS | 10.0 | 0.1 M | O=S(=O)(O)CCCNC1CCCCC1 | 
| Potassium bromide | 10.0 | 0.1 M | [K+].[Br-] | 
| PEG 20000 | 10.0 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… | 
|  | TR24 | 
|---|---|
| Spine Status | HSQC collected and crystal hits | 
| Length | 198 aa | 
| Mass | 21.22 kD | 
| ext | 2980 | 
| pI | 8.70 | 
| Name | Methyl-coenzyme M reductase I operon protein C | 
| Database References | NCBI UniProt | 
| PFAM | PF04609 | 
| PDB Structures | 4RJZ (Best Match) | 
| Gene | |
|---|---|
| Organism | Methanobacterium thermoautotrophicum | 
| Genus | Methanothermobacter | 
| Species | thermautotrophicus | 
| Strain | |
| Sequence | MIGKCTHVVDCRETMGMGEGGGIAQRGTFAQCGSEVLAVAMSPGRRHITKPVCEITFALREANIMTSTIVLNAGAGVPQDAPSAGAGSLFGLTPAEVEQMKRHKLLVVHLGGVKNHITYKARLILRNVDRPCIIICEYPVDFEDFAKIGVRTRAVMPDEPKTKGTIVDIVSGVIRGETCPQEKLDEIIRKVKLALGGA |