| Read Date | 2007-08-10 10:16:00 |
|---|---|
| Read Number | X0000091340968200708101016 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 7_C1022 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Magnesium acetate tetrahydrate | 7.0 | 0.2 M | [Mg+2].[O-]C(=O)C.[O-]C(=… |
| PEG 4000 | 7.0 | 5.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Ammonium acetate | 7.0 | 0.2 M | O=C(O)C.N |
| HEPES-Na | 7.0 | 0.1 M | OCCN1CCN(CC1)CCS(=O)(=O)O… |
![]() | SmR69 |
|---|---|
| Spine Status | HSQC collected and crystal hits |
| Length | 182 aa |
| Mass | 21.09 kD |
| ext | 10430 |
| pI | 6.36 |
| Name | Putative ribosome-associated protein |
| Database References | NCBI UniProt |
| PFAM | PF02482 |
| PDB Structures | 3LYV (Best Match) |
| Gene | |
|---|---|
| Organism | Streptococcus mutans |
| Genus | Streptococcus |
| Species | mutans |
| Strain | |
| Sequence | MIKYSIRGENIEVTDAIRNYVESKLKKIEKYFNAEQELDARINLKVYREKTAKVEVTIPLAPVTLRAEDVSQDMYGSIDLVVDKIERQIRKNKTKIAKKHREKKPAAHVFTAEFEAEEMEEAPAIKVVRTKNITLKPMDIEEARLQMDLLGHDFFIYTDANDNTTNVLYRREDGNLGLIEAK |