| Read Date | 2007-08-17 09:41:00 |
|---|---|
| Read Number | X0000091531319200708170941 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 7_C0750 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Tris | 8.0 | 0.1 M | OCC(N)(CO)CO |
| Cobalt (II) sulfate heptahydrate | 8.0 | 0.1 M | [Co+2].[O-]S([O-])(=O)=O.… |
| PEG 1000 | 8.0 | 10.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | DR64 |
|---|---|
| Spine Status | HSQC collected |
| Length | 182 aa |
| Mass | 21.10 kD |
| ext | 8940 |
| pI | 5.11 |
| Name | Ribosome-associated factor Y |
| Database References | NCBI UniProt |
| PFAM | PF02482 |
| PDB Structures | 3LYV (Best Match) |
| Gene | |
|---|---|
| Organism | Streptococcus pyogenes |
| Genus | Streptococcus |
| Species | pyogenes |
| Strain | |
| Sequence | MIKFSIRGENIEVTEAIRDYVESKLTKIEKYFAKDQEIDARVNLKVYRERSSKVEVTIPLDSVTLRAEDVSQDMYGSIDLVVDKIERQIRKNKTKIAKKHREKVPTGQVFTTEFEAEEVDEIPEVQVVRTKNVTLKPMDVEEARLQMELLGHDFFIYTDSEDGATNILYRREDGNLGLIEAK |