 
    | Read Date | 2007-09-05 10:37:00 | 
|---|---|
| Read Number | X0000091891315200709051037 | 
| Week | <nil> | 
| Verified Crystal | |
| 3-Way Classifier | crystal | 
| 10-Way Classifier | clear | 
| Cocktail | 7_C0749 | 
| Screen | HWI Generation 7 | 
| Name | pH | Concentration | SMILES | 
|---|---|---|---|
| CAPS | 10.0 | 0.1 M | O=S(=O)(O)CCCNC1CCCCC1 | 
| Potassium phosphate dibasic anhydrous | 10.0 | 0.1 M | [K+].[K+].[O-]P([O-])(=O)… | 
| PEG 1000 | 10.0 | 20.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… | 
|  | RpR5 | 
|---|---|
| Spine Status | crystal hits | 
| Length | 225 aa | 
| Mass | 24.79 kD | 
| ext | 14440 | 
| pI | 4.70 | 
| Name | NA | 
| Database References | NCBI UniProt | 
| PFAM | PF02190 | 
| PDB Structures | 3LJC (Best Match) | 
| Gene | |
|---|---|
| Organism | Rhodopseudomonas palustris | 
| Genus | Rhodopseudomonas | 
| Species | palustris | 
| Strain | |
| Sequence | MPINAAYRGPADLPEVIPVFPLAGALLLPRGQMPLNIFEPRYLAMIDDALRDGHRLIGMIQPDAAHSSETAEKPSLFNVGCVGRITQLAESGDGRYILELTGVSRFKVVDELQVLTPYRQCKVDYFPFVDDFTARKGEDEVDRETLLSVLTDFLKANNLKVDWDGVESAPNEALVNALAMMSPYGPPEKQALLEAPDLKTRAEILIAVTEMDLAKKRTSGDPPLQ |