| Read Date | 2007-09-14 10:20:00 |
|---|---|
| Read Number | X0000092261185200709141020 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | clear |
| Cocktail | 7_C0081 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| TAPS | 9.0 | 0.1 M | O=S(=O)(O)CCCNC(CO)(CO)CO |
| Magnesium sulfate heptahydrate | 9.0 | 1.6 M | [Mg+2].[O-]S([O-])(=O)=O.… |
![]() | XcR206 |
|---|---|
| Spine Status | good HSQC collected and crystal hits |
| Length | 143 aa |
| Mass | 16.03 kD |
| ext | 5500 |
| pI | 11.36 |
| Name | Peptidyl-tRNA hydrolase |
| Database References | NCBI UniProt |
| PFAM | PF00472 |
| PDB Structures | 4V95 (Best Match) |
| Gene | |
|---|---|
| Organism | Xanthomonas campestris |
| Genus | Xanthomonas |
| Species | campestris |
| Strain | |
| Sequence | MASEPIQITPNLAIPPGEIVERFVRASGAGGQNVNKVSTAVELRFDVAGSPSLPEPLRARLLSRRDRRMTADGVLVIDAQRFRTQDRNREDARERLAEIINACLSVPKRRVATKPSHGAKLRRLDAKRERSQIKRGRSASHWE |