| Read Date | 2007-10-11 13:02:00 |
|---|---|
| Read Number | X0000093361279200710111302 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | precip |
| Cocktail | 7_C0368 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium acetate trihydrate | 5.0 | 0.1 M | [Na+].[O-]C(=O)C.O.O.O |
| PEG 20000 | 5.0 | 40.0 % (w/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
| Sodium phosphate monobasic | 5.0 | 0.1 M | [Na+].[O-]P(=O)(O)O |
![]() | VpR164 |
|---|---|
| Spine Status | crystal hits |
| Length | 170 aa |
| Mass | 19.39 kD |
| ext | 1490 |
| pI | 9.45 |
| Name | Putative periplasmic protein CpxP |
| Database References | UniProt |
| PFAM | PF07813 |
| PDB Structures | 3OEO (Best Match) |
| Gene | |
|---|---|
| Organism | Vibrio parahaemolyticus |
| Genus | Vibrio |
| Species | parahaemolyticus |
| Strain | |
| Sequence | MKSAKKLVLAAVVLPLTLGTASAFAFGGKDHHKGPRDECGMGMDRGIMRDLNLTDAQKDQLQSFRDANRAEMKGKYSQNREARMAERQAHHAKMQSLLLADTFDEAQATALAKEMVERQTEHRVKMLERKHQMLSVLTPEQKAEFVKLQNERMQECGDQMQQRMGKHRNN |