| Read Date | 2007-10-12 10:32:00 |
|---|---|
| Read Number | X0000093501492200710121032 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | crystal |
| Cocktail | 7_C1525 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Potassium sodium tartrate tetrahydrate | 7.0 | 0.6 M | [K+].[Na+].O=C([O-])[C@H]… |
| Bis-Tris Propane | 7.0 | 0.1 M | OCC(NCCCNC(CO)(CO)CO)(CO)… |
![]() | TeR66 |
|---|---|
| Spine Status | HSQC collected |
| Length | 209 aa |
| Mass | 23.57 kD |
| ext | 8940 |
| pI | 7.99 |
| Name | LrtA protein |
| Database References | NCBI UniProt |
| PFAM | PF02482 |
| PDB Structures | 3KA5 (Best Match) |
| Gene | |
|---|---|
| Organism | Thermosynechococcus elongatus |
| Genus | Thermosynechococcus |
| Species | elongatus |
| Strain | |
| Sequence | MRLVIHGKNIDITDGIRSYLNQKIERATSHFQNVINEVDVHLSVARNRSTAPKQTAEVTVFVNGSVIRAEESSENLYASIDLVADKIARKLRKLKEKRQDKSRAKDTNSVVEPEVVTDLVGDRTPQLPEQVVRMKYFAMPPMTIQEALEHLEMVDHDFYVFRNRDTGEINVVYERNHGGYGVIQPRPTSNNHHHNTADAAAKATAKAGP |