| Read Date | 2007-10-12 10:54:00 |
|---|---|
| Read Number | X0000093511378200710121054 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | other |
| 10-Way Classifier | precip |
| Cocktail | 7_C0861 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium acetate trihydrate | 5.0 | 0.1 M | [Na+].[O-]C(=O)C.O.O.O |
| Magnesium acetate tetrahydrate | 5.0 | 0.1 M | [Mg+2].[O-]C(=O)C.[O-]C(=… |
| PEG 400 | 5.0 | 40.0 % (v/v) | C(CO)OC(CO)OC(CO)OC(CO)OC… |
![]() | BuR149 |
|---|---|
| Spine Status | aggregation screening |
| Length | 382 aa |
| Mass | 42.12 kD |
| ext | 18450 |
| pI | 5.01 |
| Name | Ribosomal protein S1 (30S ribosomal protein S1) |
| Database References | NCBI UniProt |
| PFAM | PF00575 |
| PDB Structures | 4Q7J (Best Match) |
| Gene | |
|---|---|
| Organism | Bacillus thuringiensis |
| Genus | Bacillus |
| Species | thuringiensis |
| Strain | |
| Sequence | MVEKMNEEVMDSKELQVGDVVTGSVTKVEEKQVLVNVGYKTDGVIPISELANVHIEKASDVVELDQTLELKVIKLEENDLVLSKRAVDAEKAWVELQEKFNSGHVFDVTVKDIVNGGLVVDLGVRGFIPASLVEVHYVEDFTDYKGKTLAVKIVELDREKNRVILSHKAVVELELDSKKKEAISSLKEGDVVEGTVQRLTDFGAFVNVGGVDGLVHISQISHERVEQPSEVLEQGQKVKVKVLSVDADTQRISLSIKAAQPGPWENVGGEVKAGDIREGVVKRLVTFGAFVEILPGVEGLVHVSQIANRHVKNPNEVLEMGQEVKVKVLEVHVAEKRISLSIKEALEENNVTEDYSQYEPNADSATFQLSDIIGEQLKKLKK |