| Read Date | 2007-11-02 13:28:00 |
|---|---|
| Read Number | X0000094361249200711021328 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | crystal |
| 10-Way Classifier | precip |
| Cocktail | 7_C0169 |
| Screen | HWI Generation 7 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| MOPS | 7.0 | 0.1 M | O=S(=O)(O)CCCN1CCOCC1 |
| Sodium molybdate dihydrate | 7.0 | 1.4 M | [Na+].[O-]C(=O)CCCCCCC(O)… |
![]() | PaR198 |
|---|---|
| Spine Status | X-Ray structure |
| Length | 132 aa |
| Mass | 14.22 kD |
| ext | 8480 |
| pI | 4.86 |
| Name | Hypothetical protein |
| Database References | NCBI UniProt |
| PFAM | PF03860 |
| PDB Structures | 3KAV (Xray) 3KAW (Xray) |
| Gene | |
|---|---|
| Organism | Pseudomonas aeruginosa |
| Genus | Pseudomonas |
| Species | aeruginosa |
| Strain | |
| Sequence | MTRAINDPGNEDPGSLLETDADALLGGAAAQAPEERCRLAAQACIRACERYLALCTESSREQRQHAGDCADLCRLAALLLERRSPWAPAACELAARYALACAERCDGDEPLERECAGACRRFVEACRPLLPA |