| Read Date | 2009-08-04 09:41:00 |
|---|---|
| Read Number | X0000112051380200908040941 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 9_C1053 |
| Screen | HWI Generation 9 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| HEPES-Na | 6.8 | 0.0 M | OCCN1CCN(CC1)CCS(=O)(=O)O… |
| HEPES-Na | 6.8 | 0.1 M | OCCN1CCN(CC1)CCS(=O)(=O)O… |
| 2,5-Pyridinedicarboxylic acid | 7.0 | 0.2 % (w/v) | O=C(O)c1ncc(C(=O)O)cc1 |
| Pyromellitic acid | 7.0 | 0.2 % (w/v) | O=C(O)c1cc(c(cc1C(=O)O)C(… |
| Salicylic acid | 7.0 | 0.2 % (w/v) | c1ccc(c(c1)C(=O)O)O |
| trans-Cinnamic acid | 7.0 | 0.2 % (w/v) | O=C(O)\C=C\c1ccccc1 |
| trans-1,2-Cyclohexanedicarboxylic acid | 7.0 | 0.2 % (w/v) | C1CCC(C(C1)C(=O)O)C(=O)O |
| Tacsimate | 7.0 | 55.0 % (v/v) | missing |
![]() | GtR17 |
|---|---|
| Spine Status | aggregation screening |
| Length | 279 aa |
| Mass | 31.98 kD |
| ext | 38390 |
| pI | 6.55 |
| Name | Putative uncharacterized protein |
| Database References | NCBI UniProt |
| PFAM | PF00753 |
| PDB Structures | 4AD9 (Best Match) |
| Gene | |
|---|---|
| Organism | Geobacillus thermodenitrificans |
| Genus | Geobacillus |
| Species | thermodenitrificans |
| Strain | |
| Sequence | MWINKVIKKRFETDIVQHVHIAKGTAMFQGVRLAVRCFVVDGVLIDTGAKSMENEFTSFFQQQDIDQVVITHFHEDHTGCAAFLQRSMGLPIYMNEPMIEYCRQKADYPLYRKIFWGKRDPFAAKPIGATFSSRNATWDVIPTPGHAIDHVVFLNRETGQLFSGDLYCQEKTKVILREEDIPTIIASLQHVLTYDFGDVFCAHAGYLPNGREALQRKLDYLLELQGTIIDLYEKGTPPKQIQALLFPKKYPIIFFSGGEWDSLHIVRSVIRDYEAKQAS |