| Read Date | 2009-08-04 09:42:00 |
|---|---|
| Read Number | X0000112051262200908040942 |
| Week | 0 |
| Verified Crystal | |
| 3-Way Classifier | |
| 10-Way Classifier | |
| Cocktail | 9_C0940 |
| Screen | HWI Generation 9 |
| Name | pH | Concentration | SMILES |
|---|---|---|---|
| Sodium citrate tribasic dihydrate | 7.5 | 0.1 M | [Na+].[Na+].[Na+].O=C([O-… |
| Iso-propanol | 7.5 | 14.0 % (v/v) | CC(C)O |
| HEPES-Na | 7.5 | 0.1 M | OCCN1CCN(CC1)CCS(=O)(=O)O… |
| Glycerol anhydrous | 7.5 | 30.0 % (v/v) | C(C(CO)O)O |
![]() | GtR17 |
|---|---|
| Spine Status | aggregation screening |
| Length | 279 aa |
| Mass | 31.98 kD |
| ext | 38390 |
| pI | 6.55 |
| Name | Putative uncharacterized protein |
| Database References | NCBI UniProt |
| PFAM | PF00753 |
| PDB Structures | 4AD9 (Best Match) |
| Gene | |
|---|---|
| Organism | Geobacillus thermodenitrificans |
| Genus | Geobacillus |
| Species | thermodenitrificans |
| Strain | |
| Sequence | MWINKVIKKRFETDIVQHVHIAKGTAMFQGVRLAVRCFVVDGVLIDTGAKSMENEFTSFFQQQDIDQVVITHFHEDHTGCAAFLQRSMGLPIYMNEPMIEYCRQKADYPLYRKIFWGKRDPFAAKPIGATFSSRNATWDVIPTPGHAIDHVVFLNRETGQLFSGDLYCQEKTKVILREEDIPTIIASLQHVLTYDFGDVFCAHAGYLPNGREALQRKLDYLLELQGTIIDLYEKGTPPKQIQALLFPKKYPIIFFSGGEWDSLHIVRSVIRDYEAKQAS |